RefMet Compound Details
RefMet ID | RM0153886 | |
---|---|---|
MW structure | 50129 (View MW Metabolite Database details) | |
RefMet name | Arachidonyl-CoA | |
Alternative name | CoA 20:4 | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 20:4 | View other entries in RefMet with this sum composition |
Exact mass | 1053.344884 (neutral) |
Table of KEGG reactions in human pathways involving Arachidonyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08183 | Arachidonyl-CoA + H2O <=> CoA + Arachidonate | Arachidonyl-CoA + H2O <=> CoA + Arachidonate |
R11059 | 8,11,14-Eicosatrienoyl-CoA + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> Arachidonyl-CoA + 2 Ferricytochrome b5 + 2 H2O | 8,11,14-eicosatrienoyl-CoA,ferrocytochrome-b5:oxygen oxidoreductase (5,6-cis-dehydrogenating) |
Table of KEGG human pathways containing Arachidonyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 2 |
hsa01212 | Fatty acid metabolism | 1 |