RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135905
RefMet nameAspartic acid
Systematic name(2S)-2-aminobutanedioic acid
SynonymsPubChem Synonyms
Exact mass133.037509 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC4H7NO4View other entries in RefMet with this formula
Molecular descriptors
Molfile37126 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
InChIKeyCKLJMWTZIZZHCS-REOHCLBHSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC([C@@H](C(=O)O)N)C(=O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Distribution of Aspartic acid in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Aspartic acid
External Links
Pubchem CID5960
ChEBI ID22660
KEGG IDC00049
HMDB IDHMDB0000191
Chemspider ID5745
MetaCyc IDL-ASPARTATE
EPA CompToxDTXCID90196663
Spectral data for Aspartic acid standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Aspartic acid

Rxn IDKEGG ReactionEnzyme
R00355 L-Aspartate + 2-Oxoglutarate <=> Oxaloacetate + L-GlutamateL-Aspartate:2-oxoglutarate aminotransferase
R00357 L-Aspartate + H2O + Oxygen <=> Oxaloacetate + Ammonia + Hydrogen peroxideL-Aspartic acid:oxygen oxidoreductase (deaminating)
R00481 L-Aspartate + Oxygen <=> Iminoaspartate + Hydrogen peroxideL-aspartate:oxygen oxidoreductase
R00483 ATP + L-Aspartate + Ammonia <=> AMP + Diphosphate + L-AsparagineL-aspartate:ammonia ligase (AMP-forming)
R00485 L-Asparagine + H2O <=> L-Aspartate + AmmoniaL-asparagine amidohydrolase
R00487 Acetyl-CoA + L-Aspartate <=> CoA + N-Acetyl-L-aspartateacetyl-CoA:L-aspartate N-acetyltransferase
R00488 N-Acetyl-L-aspartate + H2O <=> Acetate + L-AspartateN-Acetyl-L-aspartate amidohydrolase
R00489 L-Aspartate <=> beta-Alanine + CO2L-aspartate 1-carboxy-lyase (beta-alanine-forming)
R00526 N-Formyl-L-aspartate + H2O <=> Formate + L-AspartateN-Formyl-L-aspartate amidohydrolase
R00578 ATP + L-Aspartate + L-Glutamine + H2O <=> AMP + Diphosphate + L-Asparagine + L-GlutamateL-aspartate:L-glutamine amido-ligase (AMP-forming)
R01135 GTP + IMP + L-Aspartate <=> GDP + Orthophosphate + N6-(1,2-Dicarboxyethyl)-AMPIMP:L-aspartate ligase (GDP-forming)
R01397 Carbamoyl phosphate + L-Aspartate <=> Orthophosphate + N-Carbamoyl-L-aspartatecarbamoyl-phosphate:L-aspartate carbamoyltransferase
R01954 ATP + L-Citrulline + L-Aspartate <=> AMP + Diphosphate + N-(L-Arginino)succinateL-Citrulline:L-aspartate ligase (AMP-forming)
R05577 tRNA(Asp) + L-Aspartate + ATP <=> L-Aspartyl-tRNA(Asp) + Diphosphate + AMPL-Aspartate:tRNA(Asp) ligase (AMP-forming)
R07407 L-Aspartate + NADP+ <=> Iminoaspartate + NADPH + H+L-aspartate:NADP+ oxidoreductase (deaminating)
R07410 L-Aspartate + NAD+ <=> Iminoaspartate + NADH + H+L-aspartate:NAD+ oxidoreductase (deaminating)

Table of KEGG human pathways containing Aspartic acid

Pathway IDHuman Pathway# of reactions
hsa00250 Alanine, aspartate and glutamate metabolism 7
hsa01100 Metabolic pathways 4
hsa01240 Biosynthesis of cofactors 3
hsa01230 Biosynthesis of amino acids 3
hsa00220 Arginine biosynthesis 2
hsa00760 Nicotinate and nicotinamide metabolism 2
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00770 Pantothenate and CoA biosynthesis 1
hsa01200 Carbon metabolism 1
hsa01210 2-Oxocarboxylic acid metabolism 1
hsa00410 beta-Alanine metabolism 1
hsa00340 Histidine metabolism 1
  logo