RefMet Compound Details
MW structure | 42253 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Beta-Citryl-glutamic acid | |
Systematic name | 2-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanamido]pentanedioic acid | |
SMILES | C(CC(=O)O)C(C(=O)O)NC(=O)C(CC(=O)O)(CC(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 321.069596 (neutral) |
Table of KEGG reactions in human pathways involving Beta-Citryl-glutamic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R10677 | ATP + Citrate + L-Glutamate <=> ADP + Orthophosphate + beta-Citryl-L-glutamate | citrate:L-glutamate ligase (ADP-forming) |
Table of KEGG human pathways containing Beta-Citryl-glutamic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00250 | Alanine, aspartate and glutamate metabolism | 1 |