RefMet Compound Details
MW structure | 38255 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Biocytin | |
Systematic name | (2S)-6-{5-[(3aS,4S,6aR)-2-oxo-hexahydro-1H-thieno[3,4-d]imidazolidin-4-yl]pentanamido}-2-aminohexanoic acid | |
SMILES | C(CCC(=O)NCCCC[C@@H](C(=O)O)N)C[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 372.183126 (neutral) |
Table of KEGG reactions in human pathways involving Biocytin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01077 | Biocytin + H2O <=> Biotin + L-Lysine | N6-D-Biotinyl-L-lysine amidohydrolase |
Table of KEGG human pathways containing Biocytin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00780 | Biotin metabolism | 1 |