RefMet Compound Details
RefMet ID | RM0136765 | |
---|---|---|
MW structure | 50132 (View MW Metabolite Database details) | |
RefMet name | Butyryl-CoA | |
Alternative name | CoA 4:0 | |
Systematic name | 3'-phosphoadenosine 5'-(3-{(3R)-4-[(3-{[2-(butanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl} dihydrogen diphosphate) | |
SMILES | CCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 4:0 | View other entries in RefMet with this sum composition |
Exact mass | 837.157084 (neutral) |
Table of KEGG reactions in human pathways involving Butyryl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01171 | Butanoyl-CoA + NAD+ <=> Crotonoyl-CoA + NADH + H+ | butanoyl-CoA:NAD+ trans-2-oxidoreductase |
R01175 | Butanoyl-CoA + FAD <=> FADH2 + Crotonoyl-CoA | butanoyl-CoA:electron-transfer flavoprotein 2,3-oxidoreductase |
R01176 | ATP + Butanoic acid + CoA <=> AMP + Diphosphate + Butanoyl-CoA | Butanoate:CoA ligase (AMP-forming) |
R01177 | Acetyl-CoA + Butanoyl-CoA <=> CoA + 3-Oxohexanoyl-CoA | butanoyl-CoA:acetyl-CoA C-butanoyltransferase |
R01179 | Butanoyl-CoA + Acetate <=> Butanoic acid + Acetyl-CoA | butanoyl-CoA:acetate CoA-transferase |
Table of KEGG human pathways containing Butyryl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00071 | Fatty acid degradation | 2 |
hsa00650 | Butanoate metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |
hsa01212 | Fatty acid metabolism | 2 |
hsa00062 | Fatty acid elongation | 1 |
hsa01200 | Carbon metabolism | 1 |