RefMet Compound Details
RefMet name | CE 20:1 | |
---|---|---|
Alternative name | CE(20:1) | |
Systematic name | cholest-5-en-3beta-yl (11Z-eicosenoate) | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(=O)CCCCCCCCC/C=C\CCCCCCCC Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CE 20:1 | View other entries in RefMet with this sum composition |
Exact mass | 678.631480 (neutral) |
Table of KEGG reactions in human pathways involving CE 20:1
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01461 | Acyl-CoA + Cholesterol <=> CoA + Cholesterol ester | Acyl-CoA:cholesterol O-acyltransferase |
R01462 | Cholesterol ester + H2O <=> Cholesterol + Fatty acid | cholesterol ester acylhydrolase |
Table of KEGG human pathways containing CE 20:1
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |