RefMet Compound Details
RefMet ID | RM0155981 | |
---|---|---|
MW structure | 68721 (View MW Metabolite Database details) | |
RefMet name | CMP-2-trimethylaminoethylphosphonate | |
Systematic name | 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]ethyl-trimethyl-ammonium | |
SMILES | C[N+](C)(C)CCP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2ccc(N)nc2=O)O1)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 473.120241 (neutral) |
Table of KEGG reactions in human pathways involving CMP-2-trimethylaminoethylphosphonate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02590 | CTP + N-Trimethyl-2-aminoethylphosphonate <=> Diphosphate + CMP-N-trimethyl-2-aminoethylphosphonate | CTP:choline-phosphate cytidylyltransferase |
R04922 | CMP-N-trimethyl-2-aminoethylphosphonate + 1,2-Diacyl-sn-glycerol <=> CMP + Diacylglyceryl-N-trimethyl-2-aminoethylphosphonate | CMP-N-trimethyl-2-aminoethylphosphonate:1,2-diacylglycerol (N-trimethyl-2-aminoethylphosphonyl)transferase |
Table of KEGG human pathways containing CMP-2-trimethylaminoethylphosphonate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00440 | Phosphonate and phosphinate metabolism | 2 |