RefMet Compound Details
RefMet ID | RM0136370 | |
---|---|---|
MW structure | 41911 (View MW Metabolite Database details) | |
RefMet name | CMP-N-glycoloylneuraminate | |
Systematic name | (2S,4S,6R)-6-[(1S,2S)-3-[({[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]-1,2-dihydroxypropyl]-2,4-dihydroxy-5-(2-hydroxyacetamido)oxane-2-carboxylic acid | |
SMILES | c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OC[C@@H]([C@@H]([C@H]3C([C@H](C[C@](C(=O)O)(O)O3)O)NC(=O)CO)O)O)O2)O)O)c(=O)nc1N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 630.142182 (neutral) |
Table of KEGG reactions in human pathways involving CMP-N-glycoloylneuraminate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04215 | CTP + N-Glycoloyl-neuraminate <=> Diphosphate + CMP-N-glycoloylneuraminate | CTP:N-glycoloylneuraminate cytidylyltransferase |
Table of KEGG human pathways containing CMP-N-glycoloylneuraminate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |