RefMet Compound Details
RefMet ID | RM0037601 | |
---|---|---|
MW structure | 78599 (View MW Metabolite Database details) | |
RefMet name | Carbamoylaspartate | |
Systematic name | N-Carbamoyl-L-aspartate | |
SMILES | C([C@@H](C(=O)O)NC(=O)N)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 176.043323 (neutral) |
Table of KEGG reactions in human pathways involving Carbamoylaspartate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00484 | N-Carbamoyl-L-aspartate + H2O <=> L-Aspartate + CO2 + Ammonia | N-Carbamoyl-L-aspartate amidohydrolase |
R01397 | Carbamoyl phosphate + L-Aspartate <=> Orthophosphate + N-Carbamoyl-L-aspartate | carbamoyl-phosphate:L-aspartate carbamoyltransferase |
R01993 | (S)-Dihydroorotate + H2O <=> N-Carbamoyl-L-aspartate | (S)-dihydroorotate amidohydrolase |
Table of KEGG human pathways containing Carbamoylaspartate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 2 |
hsa00250 | Alanine, aspartate and glutamate metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |