RefMet Compound Details
MW structure | 37048 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cellobiose | |
Systematic name | beta-D-glucopyranosyl-(1->4)-beta-D-glucopyranose | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](CO)O[C@H]([C@@H]([C@H]1O)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Cellobiose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00306 | Cellobiose + H2O <=> 2 D-Glucose | cellobiose glucohydrolase |
R11308 | Cellodextrin <=> Cellobiose | Cellodextrin <=> Cellobiose |
R02887 | Cellodextrin + (n-2) H2O <=> (n-2) D-Glucose + Cellobiose | 1,4-beta-D-Glucan glucohydrolase |
Table of KEGG human pathways containing Cellobiose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00500 | Starch and sucrose metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |