RefMet Compound Details
MW structure | 87727 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cer 14:0;O3/10:0 | |
Alternative name | Cer(t14:0/10:0) | |
Systematic name | N-(decanoyl)-4R-hydroxytetradecasphinganine | |
SMILES | CCCCCCCCCC[C@H]([C@H]([C@H](CO)NC(=O)CCCCCCCCC)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | Cer 24:0;O3 | View other entries in RefMet with this sum composition |
Exact mass | 415.366159 (neutral) |
Table of KEGG reactions in human pathways involving Cer 14:0;O3/10:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R06526 | Dihydroceramide + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> Phytoceramide + 2 Ferricytochrome b5 + H2O | dihydroceramide,ferrocytochrome b5:oxygen oxidoreductase (C4-hydroxylating) |
R06527 | C26-CoA + Phytosphingosine <=> CoA + Phytoceramide | acyl-CoA: phytosphingosine N-acyltransferase |
R06528 | Phytoceramide + H2O <=> Fatty acid + Phytosphingosine | Phytoceramide amidohydrolase |
Table of KEGG human pathways containing Cer 14:0;O3/10:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00600 | Sphingolipid metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |