RefMet Compound Details
RefMet ID | RM0157496 | |
---|---|---|
MW structure | 88076 (View MW Metabolite Database details) | |
RefMet name | CerP 15:1;O2/11:0 | |
Alternative name | CerP(d15:1/11:0) | |
Systematic name | N-(undecanoyl)-4E-pentadecasphingenine-1-phosphate | |
SMILES | CCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)NC(=O)CCCCCCCCCC)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CerP 26:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 505.353227 (neutral) |
Table of KEGG reactions in human pathways involving CerP 15:1;O2/11:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01495 | ATP + N-Acylsphingosine <=> ADP + Ceramide 1-phosphate | ATP:ceramide 1-phosphotransferase |
R06522 | Ceramide 1-phosphate + H2O <=> N-Acylsphingosine + Orthophosphate | 3-sn-phosphatidate phosphohydrolase |
Table of KEGG human pathways containing CerP 15:1;O2/11:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00600 | Sphingolipid metabolism | 2 |