RefMet Compound Details

MW structure34361 (View MW Metabolite Database details)
RefMet nameCholesterol
Systematic namecholest-5-en-3beta-ol
SMILESCC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Sum CompositionST 27:1;O View other entries in RefMet with this sum composition
Exact mass386.354865 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC27H46OView other entries in RefMet with this formula
InChIInChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10
-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1
InChIKeyHVYWMOMLDIMFJA-DPAQBDIFSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassSterol Lipids
Main ClassSterols
Sub ClassCholesterols
Pubchem CID5997
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Cholesterol

Rxn IDKEGG ReactionEnzyme
R07218 Cholesterol + Reduced acceptor + Oxygen <=> 25-Hydroxycholesterol + Acceptor + H2Ocholesterol,hydrogen-donor:oxygen oxidoreductase (25-hydroxylating)
R07207 Cholesterol + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Cerebrosterol + [Oxidized NADPH---hemoprotein reductase] + H2Ocholesterol,NADPH-hemoprotein reductase:oxygen oxidoreductase (24-hydroxylating)
R02723 Cholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 22(R)-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxinCholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 22(R)-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin
R01461 Acyl-CoA + Cholesterol <=> CoA + Cholesterol esterAcyl-CoA:cholesterol O-acyltransferase
R08941 Cholesterol + Sulfate <=> Cholesterol sulfate + H2OCholesterol-sulfate sulfohydrolase
R01456 Cholesterol + NADP+ <=> 7-Dehydrocholesterol + NADPH + H+cholesterol:NADP+ delta7-oxidoreductase
R08977 Cholesterol + 3'-Phosphoadenylyl sulfate <=> Cholesterol sulfate + Adenosine 3',5'-bisphosphate3'-phosphoadenylyl-sulfate:cholesterol sulfotransferase
R01454 Cholesterol + Oxygen + 2 H+ + 2 Reduced adrenal ferredoxin <=> 20alpha-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxinCholesterol:oxygen oxidoreductase (side-chain-cleaving)
R01462 Cholesterol ester + H2O <=> Cholesterol + Fatty acidcholesterol ester acylhydrolase
R01463 Cholesterol + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> 7alpha-Hydroxycholesterol + [Oxidized NADPH---hemoprotein reductase] + H2Ocholesterol,NADPH-hemoprotein reductase:oxygen oxidoreductase (7alpha-hydroxylating)
R08505 Cholesterol + Oxygen + 2 H+ + 2 Reduced adrenal ferredoxin <=> Cholest-5-ene-3beta,26-diol + H2O + 2 Oxidized adrenal ferredoxincholesterol 26-hydroxylase
R01451 Cholesterol + NAD+ <=> 7-Dehydrocholesterol + NADH + H+Cholesterol:NAD+ delta7-oxidoreductase
R01457 Cholesterol + NADP+ <=> Desmosterol + H+ + NADPHcholesterol:NADP+ Delta24-oxidoreductase

Table of KEGG human pathways containing Cholesterol

Pathway IDHuman Pathway# of reactions
hsa00100 Steroid biosynthesis 5
hsa00120 Primary bile acid biosynthesis 4
hsa00140 Steroid hormone biosynthesis 4
hsa01100 Metabolic pathways 2
  logo