RefMet Compound Details
MW structure | 38458 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cinnavalininate | |
Systematic name | 2-amino-3-oxo-3H-phenoxazine-1,9-dicarboxylic acid | |
SMILES | c1cc(c2c(c1)oc1cc(=O)c(c(c1n2)C(=O)O)N)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 300.038238 (neutral) |
Table of KEGG reactions in human pathways involving Cinnavalininate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02670 | 2 3-Hydroxyanthranilate + 4 Oxygen <=> Cinnavalininate + 2 Superoxide + 2 Hydrogen peroxide + 2 H+ | 2 3-Hydroxyanthranilate + 4 Oxygen <=> Cinnavalininate + 2 Superoxide + 2 Hydrogen peroxide + 2 H+ |
Table of KEGG human pathways containing Cinnavalininate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |