RefMet Compound Details
RefMet ID | RM0136224 | |
---|---|---|
MW structure | 38330 (View MW Metabolite Database details) | |
RefMet name | Cob(I)alamin | |
SMILES | Cc1cc2c(cc1C)N1=CN2C2C(C([C@H](CO)O2)OP(=O)(O)OC(C)CNC(=O)CC[C@]2(C)[C@@H](CC(=O)N)C3=N4C2=C(C)C2=N5C(=CC6=N7C(=C(C)C8=N([C@]3(C)[C@@](C)(CC(=O)N)[C@@H]8CCC(=O)N)[Co]1457)[C@@](C)(CC(=O)N)[C@@H]6CCC(=O)N)C(C)(C)[C@@H]2CCC(=O)N)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 1328.564331 (neutral) |
Table of KEGG reactions in human pathways involving Cob(I)alamin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01492 | ATP + Cob(I)alamin <=> Triphosphate + Cobamide coenzyme | ATP:cob(I)alamin Co-beta-adenosyltransferase |
Table of KEGG human pathways containing Cob(I)alamin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 1 |