RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0138922 | |
---|---|---|
RefMet name | Cytidine | |
Systematic name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-dihydropyrimidin-2-one | |
Synonyms | PubChem Synonyms | |
Exact mass | 243.085522 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C9H13N3O5 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37069 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1 | |
InChIKey | UHDGCWIWMRVCDJ-XVFCMESISA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)nc1N
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Nucleic acids | |
Main Class | Pyrimidines | |
Sub Class | Pyrimidine ribonucleosides | |
Distribution of Cytidine in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Cytidine | |
External Links | ||
Pubchem CID | 6175 | |
ChEBI ID | 17562 | |
KEGG ID | C00475 | |
HMDB ID | HMDB0000089 | |
Chemspider ID | 5940 | |
MetaCyc ID | CYTIDINE | |
EPA CompTox | DTXCID80196738 | |
Spectral data for Cytidine standards | ||
BMRB ID(NMR) | View NMR spectra | |
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Cytidine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00511 | CMP + H2O <=> Cytidine + Orthophosphate | cytidine-5'-monophosphate phosphohydrolase |
R00513 | ATP + Cytidine <=> ADP + CMP | ATP:cytidine 5'-phosphotransferase |
R00516 | UTP + Cytidine <=> UDP + CMP | UTP:cytidine 5'-phosphotransferase |
R00517 | GTP + Cytidine <=> GDP + CMP | GTP:cytidine 5'-phosphotransferase |
R00962 | ITP + Cytidine <=> IDP + CMP | ITP:cytidine 5'-phosphotransferase |
R01548 | dATP + Cytidine <=> dADP + CMP | dATP:cytidine 5'-phosphotransferase |
R01878 | Cytidine + H2O <=> Uridine + Ammonia | Cytidine aminohydrolase |
R02091 | dGTP + Cytidine <=> dGDP + CMP | dGTP:cytidine 5'-phosphotransferase |
R02096 | dTTP + Cytidine <=> dTDP + CMP | dTTP:cytidine 5'-phosphotransferase |
R02371 | dCTP + Cytidine <=> dCDP + CMP | dCTP:cytidine 5'-phosphotransferase |
R02372 | dUTP + Cytidine <=> dUDP + CMP | dUTP:cytidine 5'-phosphotransferase |
Table of KEGG human pathways containing Cytidine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 4 |
hsa01100 | Metabolic pathways | 2 |
hsa01232 | Nucleotide metabolism | 2 |