RefMet Compound Details
MW structure | 50432 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | D-Ribitol 5-phosphate | |
Systematic name | 5-O-phosphono-D-ribitol;D-ribitol 5-(dihydrogen phosphate) | |
SMILES | C([C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 232.034804 (neutral) |
Table of KEGG reactions in human pathways involving D-Ribitol 5-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02921 | CTP + D-Ribitol 5-phosphate <=> Diphosphate + CDP-ribitol | CTP:D-ribitol-5-phosphate cytidylyltransferase |
Table of KEGG human pathways containing D-Ribitol 5-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 1 |
hsa00515 | Mannose type O-glycan biosynthesis | 1 |