RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0034437 | |
---|---|---|
RefMet name | D-Ribosylnicotinate | |
Systematic name | 1-(beta-D-ribofuranosyl)pyridinium-3-carboxylate | |
Synonyms | PubChem Synonyms | |
Exact mass | 255.074289 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C11H13NO6 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 59971 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C11H13NO6/c13-5-7-8(14)9(15)10(18-7)12-3-1-2-6(4-12)11(16)17/h1-4,7-10,13-15H,5H2/t7-,8-,9-,10-/m1/s1 | |
InChIKey | PUEDDPCUCPRQNY-ZYUZMQFOSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | c1cc(c[n+](c1)[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O)C(=O)[O-]
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Alkaloids | |
Main Class | Pyridine alkaloids | |
Sub Class | Nicotinic acid alkaloids | |
Distribution of D-Ribosylnicotinate in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting D-Ribosylnicotinate | |
External Links | ||
Pubchem CID | 161233 | |
ChEBI ID | 58527 | |
KEGG ID | C05841 | |
HMDB ID | HMDB0006809 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving D-Ribosylnicotinate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02295 | Nicotinate D-ribonucleoside + Orthophosphate <=> Nicotinate + alpha-D-Ribose 1-phosphate + H+ | Nicotinate D-ribonucleoside:orthophosphate ribosyltransferase |
R03346 | Nicotinate D-ribonucleotide + H2O <=> Nicotinate D-ribonucleoside + Orthophosphate | nicotinate D-ribonucleotide phosphohydrolase |
R03347 | Nicotinate D-ribonucleotide + ADP <=> Nicotinate D-ribonucleoside + ATP | ATP:beta-D-ribosylnicotinate 5-phosphotransferase |
R10046 | Nicotinate D-ribonucleoside + H2O <=> Nicotinate + D-Ribose | nicotinate D-ribonucleoside ribohydrolase |
Table of KEGG human pathways containing D-Ribosylnicotinate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00760 | Nicotinate and nicotinamide metabolism | 3 |
hsa01100 | Metabolic pathways | 1 |