RefMet Compound Details
RefMet ID | RM0136355 | |
---|---|---|
MW structure | 41464 (View MW Metabolite Database details) | |
RefMet name | D-Xylono-1,5-lactone | |
Systematic name | (3R,4S,5R)-3,4,5-trihydroxyoxan-2-one | |
SMILES | C1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 148.037175 (neutral) |
Table of KEGG reactions in human pathways involving D-Xylono-1,5-lactone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01429 | D-Xylose + NAD+ <=> D-Xylonolactone + NADH + H+ | D-xylose:NAD+ 1-oxidoreductase |
R01430 | D-Xylose + NADP+ <=> D-Xylonolactone + NADPH + H+ | D-xylose:NADP+ 1-oxidoreductase |
Table of KEGG human pathways containing D-Xylono-1,5-lactone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 1 |
hsa01100 | Metabolic pathways | 1 |