RefMet Compound Details
MW structure | 38403 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | D-myo-Inositol 3,4,5,6-tetrakisphosphate | |
Systematic name | {[(1R,2S,3R,4S,5S,6R)-3,4-dihydroxy-2,5,6-tris(phosphonooxy)cyclohexyl]oxy}phosphonic acid | |
SMILES | [C@@H]1([C@H]([C@@H]([C@H]([C@@H]([C@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 499.928722 (neutral) |
Table of KEGG reactions in human pathways involving D-myo-Inositol 3,4,5,6-tetrakisphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03479 | ATP + 1D-myo-Inositol 3,4,5,6-tetrakisphosphate <=> ADP + 1D-myo-Inositol 1,3,4,5,6-pentakisphosphate | ATP:1D-myo-inositol-3,4,5,6-tetrakisphosphate 1-phosphotransferase |
Table of KEGG human pathways containing D-myo-Inositol 3,4,5,6-tetrakisphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00562 | Inositol phosphate metabolism | 1 |