RefMet Compound Details

MW structure6111 (View MW Metabolite Database details)
RefMet nameDG 14:1(9Z)/14:1(9Z)/0:0
SMILESCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCC/C=C\CCCC   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass508.4128 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC31H56O5View other entries in RefMet with this formula
Super ClassGlycerolipids
Main ClassDiradylglycerols
Sub ClassDG
Pubchem CID53477973
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving DG 14:1(9Z)/14:1(9Z)/0:0

Rxn IDKEGG ReactionEnzyme
R02240 ATP + 1,2-Diacyl-sn-glycerol <=> ADP + PhosphatidateATP:1,2-diacylglycerol 3-phosphotransferase
R02251 Triacylglycerol + CoA <=> 1,2-Diacyl-sn-glycerol + Acyl-CoAacyl-CoA:1,2-diacyl-sn-glycerol O-acyltransferase
R02239 Phosphatidate + H2O <=> 1,2-Diacyl-sn-glycerol + Orthophosphate1,2-diacyl-sn-glycerol 3-phosphate phosphohydrolase
R03755 Acyl-CoA + 1-Acylglycerol <=> CoA + 1,2-Diacyl-sn-glycerolacyl-CoA:2-acylglycerol O-acyltransferase
R03756 2,3-Dehydroacyl-CoA + 1-Acylglycerol <=> CoA + 1,2-Diacyl-sn-glycerol2,3-dehydroacyl-CoA:2-acylglycerol O-acyltransferase
R02250 Triacylglycerol + H2O <=> 1,2-Diacyl-sn-glycerol + Fatty acidtriacylglycerol acylhydrolase
R02687 1,2-Diacyl-sn-glycerol + H2O <=> 1-Acylglycerol + Fatty acid1,2-diacyl-sn-glycerol acylhydrolase
R05333 Phospholipid + 1,2-Diacyl-sn-glycerol <=> Lysophospholipid + TriacylglycerolPhospholipid:1,2-diacyl-sn-glycerol O-acyltransferase
R09944 CTP + 1,2-Diacyl-sn-glycerol <=> CDP + PhosphatidateCTP:1,2-diacyl-sn-glycerol 3-phosphotransferase

Table of KEGG human pathways containing DG 14:1(9Z)/14:1(9Z)/0:0

Pathway IDHuman Pathway# of reactions
hsa00561 Glycerolipid metabolism 8
hsa00564 Glycerophospholipid metabolism 4
hsa01100 Metabolic pathways 4
hsa04070 Phosphatidylinositol signaling system 3
  logo