RefMet Compound Details
MW structure | 51737 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Decanoyl-CoA | |
Alternative name | CoA 10:0 | |
Systematic name | 3'-phosphoadenosine 5'-(3-{(3R)-4-[(3-{[2-(decanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl} dihydrogen diphosphate) | |
SMILES | CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | nCoA 10:0 | View other entries in RefMet with this sum composition |
Exact mass | 921.250984 (neutral) |
Table of KEGG reactions in human pathways involving Decanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04754 | Decanoyl-CoA + FAD <=> trans-Dec-2-enoyl-CoA + FADH2 | decanoyl-CoA:electron-transfer flavoprotein 2,3-oxidoreductase |
R04742 | Decanoyl-CoA + Acetyl-CoA <=> CoA + 3-Oxododecanoyl-CoA | Decanoyl-CoA:acetyl-CoA C-acyltransferase |
R04753 | Decanoyl-CoA + NADP+ <=> trans-Dec-2-enoyl-CoA + NADPH + H+ | trans-Dec-2-enoyl-CoA reductase |
Table of KEGG human pathways containing Decanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01212 | Fatty acid metabolism | 3 |
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |