RefMet Compound Details
RefMet ID | RM0049845 | |
---|---|---|
MW structure | 37076 (View MW Metabolite Database details) | |
RefMet name | Deoxyadenosine | |
Systematic name | (2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | |
SMILES | C1[C@@H]([C@@H](CO)O[C@H]1n1cnc2c(N)ncnc12)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 251.101840 (neutral) |
Table of KEGG reactions in human pathways involving Deoxyadenosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02088 | dAMP + H2O <=> Deoxyadenosine + Orthophosphate | 2'-deoxyadenosine 5'-monophosphate phosphohydrolase |
R02089 | ATP + Deoxyadenosine <=> ADP + dAMP | ATP:deoxyadenosine 5'-phosphotransferase |
R02556 | Deoxyadenosine + H2O <=> Deoxyinosine + Ammonia | Deoxyadenosine aminohydrolase |
R02557 | Deoxyadenosine + Orthophosphate <=> Adenine + 2-Deoxy-D-ribose 1-phosphate | Deoxyadenosine:orthophosphate ribosyltransferase |
Table of KEGG human pathways containing Deoxyadenosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 4 |
hsa01100 | Metabolic pathways | 1 |
hsa01232 | Nucleotide metabolism | 1 |