RefMet Compound Details
RefMet ID | RM0138944 | |
---|---|---|
MW structure | 37742 (View MW Metabolite Database details) | |
RefMet name | Deoxyribose 1-phosphate | |
Systematic name | {[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy}phosphonic acid | |
SMILES | C1[C@@H]([C@@H](CO)OC1OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 214.024243 (neutral) |
Table of KEGG reactions in human pathways involving Deoxyribose 1-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02749 | 2-Deoxy-D-ribose 1-phosphate <=> 2-Deoxy-D-ribose 5-phosphate | 2-deoxy-D-ribose 1-phosphate 1,5-phosphomutase |
Table of KEGG human pathways containing Deoxyribose 1-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 1 |