RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0136037 | |
---|---|---|
RefMet name | Dihydrofolic acid | |
Systematic name | (2S)-2-[(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 443.155333 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C19H21N7O6 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37574 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5 -8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t12-/m0/s1 | |
InChIKey | OZRNSSUDZOLUSN-LBPRGKRZSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC1=Nc2c(NC1)nc(N)[nH]c2=O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organoheterocyclic compounds | |
Main Class | Pterins | |
Sub Class | Folic acids | |
Distribution of Dihydrofolic acid in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Dihydrofolic acid | |
External Links | ||
Pubchem CID | 135398604 | |
ChEBI ID | 15633 | |
KEGG ID | C00415 | |
HMDB ID | HMDB0001056 | |
Chemspider ID | 89228 | |
MetaCyc ID | DIHYDROFOLATE | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Dihydrofolic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00936 | Tetrahydrofolate + NAD+ <=> Dihydrofolate + NADH + H+ | 5,6,7,8-tetrahydrofolate:NAD+ oxidoreductase |
R00939 | Tetrahydrofolate + NADP+ <=> Dihydrofolate + NADPH + H+ | 5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase |
R02101 | dUMP + 5,10-Methylenetetrahydrofolate <=> Dihydrofolate + dTMP | 5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase |
R02235 | Dihydrofolate + NAD+ <=> Folate + NADH + H+ | dihydrofolate:NAD+ oxidoreductase |
R02236 | Dihydrofolate + NADP+ <=> Folate + NADPH + H+ | dihydrofolate:NADP+ oxidoreductase |
R02237 | ATP + Dihydropteroate + L-Glutamate <=> ADP + Orthophosphate + Dihydrofolate | 7,8-dihydropteroate:L-glutamate ligase (ADP-forming) |
Table of KEGG human pathways containing Dihydrofolic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00790 | Folate biosynthesis | 5 |
hsa00670 | One carbon pool by folate | 4 |
hsa01100 | Metabolic pathways | 4 |
hsa01240 | Biosynthesis of cofactors | 4 |