RefMet Compound Details

RefMet IDRM0136037
MW structure37574 (View MW Metabolite Database details)
RefMet nameDihydrofolic acid
Systematic name(2S)-2-[(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
SMILESc1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC1=Nc2c(NC1)nc(N)[nH]c2=O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass443.155333 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC19H21N7O6View other entries in RefMet with this formula
InChIInChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5
-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t12-/m0/s1
InChIKeyOZRNSSUDZOLUSN-LBPRGKRZSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganoheterocyclic compounds
Main ClassPterins
Sub ClassFolic acids
Pubchem CID135398604
ChEBI ID15633
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Dihydrofolic acid

Rxn IDKEGG ReactionEnzyme
R00936 Tetrahydrofolate + NAD+ <=> Dihydrofolate + NADH + H+5,6,7,8-tetrahydrofolate:NAD+ oxidoreductase
R00939 Tetrahydrofolate + NADP+ <=> Dihydrofolate + NADPH + H+5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase
R02101 dUMP + 5,10-Methylenetetrahydrofolate <=> Dihydrofolate + dTMP5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase
R02235 Dihydrofolate + NAD+ <=> Folate + NADH + H+dihydrofolate:NAD+ oxidoreductase
R02236 Dihydrofolate + NADP+ <=> Folate + NADPH + H+dihydrofolate:NADP+ oxidoreductase
R02237 ATP + Dihydropteroate + L-Glutamate <=> ADP + Orthophosphate + Dihydrofolate7,8-dihydropteroate:L-glutamate ligase (ADP-forming)

Table of KEGG human pathways containing Dihydrofolic acid

Pathway IDHuman Pathway# of reactions
hsa00790 Folate biosynthesis 5
hsa00670 One carbon pool by folate 4
hsa01100 Metabolic pathways 4
hsa01240 Biosynthesis of cofactors 4
  logo