RefMet Compound Details
RefMet ID | RM0138838 | |
---|---|---|
MW structure | 27998 (View MW Metabolite Database details) | |
RefMet name | Dimethylallyl-diphosphate | |
Systematic name | 3-methylbut-2-enyl pyrophosphate (dimethylallyl-diphosphate) | |
SMILES | CC(=CCOP(=O)(O)OP(=O)(O)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 246.005831 (neutral) |
Table of KEGG reactions in human pathways involving Dimethylallyl-diphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01122 | Dimethylallyl diphosphate + tRNA <=> Diphosphate + tRNA containing 6-isopentenyladenosine | delta2-isopentenyl-diphosphate:tRNA isopentenyltransferase |
R01123 | Isopentenyl diphosphate <=> Dimethylallyl diphosphate | Isopentenyl-diphosphate delta3-delta2-isomerase |
Table of KEGG human pathways containing Dimethylallyl-diphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00900 | Terpenoid backbone biosynthesis | 2 |
hsa01100 | Metabolic pathways | 1 |