RefMet Compound Details
MW structure | 37845 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | FMN | |
Systematic name | {[(2R,3S,4S)-5-{7,8-dimethyl-2,4-dioxo-2H,3H,4H,10H-benzo[g]pteridin-10-yl}-2,3,4-trihydroxypentyl]oxy}phosphonic acid | |
SMILES | Cc1cc2c(cc1C)n(C[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)c1c(c(=O)[nH]c(=O)n1)n2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 456.104619 (neutral) |
Table of KEGG reactions in human pathways involving FMN
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00160 | FAD + H2O <=> AMP + FMN | FAD nucleotidohydrolase |
R00548 | FMN + H2O <=> Riboflavin + Orthophosphate | riboflavin-5-phosphate phosphohydrolase |
R00549 | ATP + Riboflavin <=> ADP + FMN | ATP:riboflavin 5'-phosphotransferase |
R00161 | ATP + FMN <=> Diphosphate + FAD | ATP:FMN adenylyltransferase |
R00550 | D-Glucose 1-phosphate + Riboflavin <=> D-Glucose + FMN | D-Glucose-1-phosphate:riboflavin 5'-phosphotransferase |
R08574 | CTP + Riboflavin <=> CDP + FMN | CTP:riboflavin 5'-phosphotransferase |
Table of KEGG human pathways containing FMN
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00740 | Riboflavin metabolism | 4 |
hsa01100 | Metabolic pathways | 2 |