RefMet Compound Details
MW structure | 37465 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Formiminoglutamic acid | |
Systematic name | (2S)-2-methanimidamidopentanedioic acid | |
SMILES | C(CC(=O)O)[C@@H](C(=O)O)NC=N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 174.064058 (neutral) |
Table of KEGG reactions in human pathways involving Formiminoglutamic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02285 | N-Formimino-L-glutamate + H2O <=> L-Glutamate + Formamide | N-Formimino-L-glutamate formiminohydrolase |
R02287 | 5-Formiminotetrahydrofolate + L-Glutamate <=> Tetrahydrofolate + N-Formimino-L-glutamate | 5-Formiminotetrahydrofolate:L-glutamate N-formiminotransferase |
R02288 | 4-Imidazolone-5-propanoate + H2O <=> N-Formimino-L-glutamate | 4-imidazolone-5-propanoate amidohydrolase |
Table of KEGG human pathways containing Formiminoglutamic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00340 | Histidine metabolism | 2 |
hsa00670 | One carbon pool by folate | 1 |
hsa01100 | Metabolic pathways | 1 |