RefMet Compound Details
MW structure | 42145 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Formyl-5-hydroxykynurenamine | |
Systematic name | N-[2-(3-aminopropanoyl)-4-hydroxyphenyl]formamide | |
SMILES | c1cc(c(cc1O)C(=O)CCN)NC=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 208.084793 (neutral) |
Table of KEGG reactions in human pathways involving Formyl-5-hydroxykynurenamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02909 | Serotonin + Oxygen <=> Formyl-5-hydroxykynurenamine | 5-hydroxytryptamine:oxygen 2,3-dioxygenase (indole-decyclizing) |
Table of KEGG human pathways containing Formyl-5-hydroxykynurenamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |