RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0030190 | |
---|---|---|
RefMet name | Fructose 6-phosphate | |
Systematic name | {[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy}phosphonic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 260.029723 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C6H13O9P | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 38436 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 | |
InChIKey | BGWGXPAPYGQALX-ARQDHWQXSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C([C@@H]1[C@H]([C@@H]([C@](CO)(O)O1)O)O)OP(=O)(O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Carbohydrates | |
Main Class | Monosaccharides | |
Sub Class | Hexose phosphates | |
Distribution of Fructose 6-phosphate in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Fructose 6-phosphate | |
External Links | ||
Pubchem CID | 440641 | |
ChEBI ID | 16084 | |
KEGG ID | C00085 | |
HMDB ID | HMDB0003971 | |
Chemspider ID | 389526 | |
Spectral data for Fructose 6-phosphate standards | ||
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Fructose 6-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00756 | ATP + D-Fructose 6-phosphate <=> ADP + D-Fructose 1,6-bisphosphate | ATP:D-fructose-6-phosphate 1-phosphotransferase |
R00760 | ATP + D-Fructose <=> ADP + D-Fructose 6-phosphate | ATP:D-fructose 6-phosphotransferase |
R00761 | D-Fructose 6-phosphate + Orthophosphate <=> Acetyl phosphate + D-Erythrose 4-phosphate + H2O | D-fructose-6-phosphate D-erythrose-4-phosphate-lyase (adding phosphate |
R00762 | D-Fructose 1,6-bisphosphate + H2O <=> D-Fructose 6-phosphate + Orthophosphate | D-Fructose-1,6-bisphosphate 1-phosphohydrolase |
R00765 | D-Glucosamine 6-phosphate + H2O <=> D-Fructose 6-phosphate + Ammonia | D-glucosamine-6-phosphate aminohydrolase (ketol isomerizing) |
R00768 | L-Glutamine + D-Fructose 6-phosphate <=> L-Glutamate + D-Glucosamine 6-phosphate | L-glutamine:D-fructose-6-phosphate isomerase (deaminating) |
R00771 | D-Glucose 6-phosphate <=> D-Fructose 6-phosphate | D-glucose-6-phosphate aldose-ketose-isomerase |
R00867 | ATP + D-Fructose <=> ADP + beta-D-Fructose 6-phosphate | ATP:D-fructose 6-phosphotransferase |
R01067 | D-Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate <=> D-Erythrose 4-phosphate + D-Xylulose 5-phosphate | D-Fructose 6-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase |
R01819 | D-Mannose 6-phosphate <=> beta-D-Fructose 6-phosphate | D-mannose-6-phosphate aldose-ketose-isomerase |
R01830 | beta-D-Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate <=> D-Erythrose 4-phosphate + D-Xylulose 5-phosphate | beta-D-Fructose 6-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase |
R02073 | Diphosphate + beta-D-Fructose 6-phosphate <=> Orthophosphate + beta-D-Fructose 1,6-bisphosphate | diphosphate:beta-D-fructose-6-phosphate 1-phosphotransferase |
R02731 | beta-D-Fructose 2,6-bisphosphate + H2O <=> beta-D-Fructose 6-phosphate + Orthophosphate | D-Fructose-2,6-bisphosphate 2-phosphohydrolase |
R02732 | ATP + beta-D-Fructose 6-phosphate <=> ADP + beta-D-Fructose 2,6-bisphosphate | ATP:D-fructose-6-phosphate 2-phosphotransferase |
R02740 | alpha-D-Glucose 6-phosphate <=> beta-D-Fructose 6-phosphate | alpha-D-Glucose 6-phosphate ketol-isomerase |
R03321 | beta-D-Glucose 6-phosphate <=> beta-D-Fructose 6-phosphate | beta-D-Glucose 6-phosphate ketol-isomerase |
R03920 | ATP + beta-D-Fructose <=> ADP + beta-D-Fructose 6-phosphate | ATP:D-fructose 6-phosphotransferase |
R04779 | ATP + beta-D-Fructose 6-phosphate <=> ADP + beta-D-Fructose 1,6-bisphosphate | ATP:D-fructose-6-phosphate 1-phosphotransferase |
R04780 | beta-D-Fructose 1,6-bisphosphate + H2O <=> beta-D-Fructose 6-phosphate + Orthophosphate | beta-D-Fructose 1,6-bisphosphate 1-phosphohydrolase |
R05805 | ADP + D-Fructose 6-phosphate <=> AMP + D-Fructose 1,6-bisphosphate | ADP:D-fructose-6-phosphate 1-phosphotransferase |
R09084 | beta-D-Fructose 6-phosphate + ADP <=> beta-D-Fructose 1,6-bisphosphate + AMP | ADP:D-fructose-6-phosphate 1-phosphotransferase |
Table of KEGG human pathways containing Fructose 6-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 7 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 5 |
hsa00030 | Pentose phosphate pathway | 5 |
hsa00051 | Fructose and mannose metabolism | 5 |
hsa00010 | Glycolysis / Gluconeogenesis | 4 |
hsa01200 | Carbon metabolism | 4 |
hsa01230 | Biosynthesis of amino acids | 4 |
hsa00500 | Starch and sucrose metabolism | 2 |
hsa00250 | Alanine, aspartate and glutamate metabolism | 1 |