RefMet Compound Details
MW structure | 37659 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | GDP | |
Systematic name | [({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2nc(N)[nH]c3=O)O1)O)O)OP(=O)(O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 443.024336 (neutral) |
Table of KEGG reactions in human pathways involving GDP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00332 | ATP + GMP <=> ADP + GDP | ATP:GMP phosphotransferase |
R00330 | ATP + GDP <=> ADP + GTP | ATP:GDP phosphotransferase |
R02019 | dGDP + Thioredoxin disulfide + H2O <=> GDP + Thioredoxin | 2'-Deoxyguanosine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase |
R00430 | GTP + Pyruvate <=> GDP + Phosphoenolpyruvate | GTP:pyruvate 2-O-phosphotransferase |
R00328 | GDP + H2O <=> GMP + Orthophosphate | GDP phosphohydrolase |
R00335 | GTP + H2O <=> GDP + Orthophosphate | GTP phosphohydrolase |
R00336 | Guanosine 3',5'-bis(diphosphate) + H2O <=> GDP + Diphosphate | guanosine-3',5'-bis(diphosphate) 3'-diphosphohydrolase |
Table of KEGG human pathways containing GDP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 7 |