RefMet Compound Details
MW structure | 37740 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | GDP-4-Dehydro-6-deoxy-D-mannose | |
Systematic name | {[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}[({[(2R,3S,4R,6R)-3,4-dihydroxy-6-methyl-5-oxooxan-2-yl]oxy}(hydroxy)phosphoryl)oxy]phosphinic acid | |
SMILES | C[C@@H]1C(=O)[C@@H]([C@@H]([C@H](O1)OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c2nc(N)[nH]c3=O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 587.066588 (neutral) |
Table of KEGG reactions in human pathways involving GDP-4-Dehydro-6-deoxy-D-mannose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00888 | GDP-mannose <=> GDP-4-dehydro-6-deoxy-D-mannose + H2O | GDP-alpha-D-mannose 4,6-hydro-lyase (GDP-4-dehydro-alpha-D-rhamnose-forming) |
R05692 | GDP-L-fucose + NADP+ <=> GDP-4-dehydro-6-deoxy-D-mannose + NADPH + H+ | GDP-L-fucose:NADP+ 4-oxidoreductase (3,5-epimerizing) |
Table of KEGG human pathways containing GDP-4-Dehydro-6-deoxy-D-mannose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00051 | Fructose and mannose metabolism | 2 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 2 |