RefMet Compound Details
RefMet ID | RM0157861 | |
---|---|---|
MW structure | 37631 (View MW Metabolite Database details) | |
RefMet name | GDP-mannose | |
Systematic name | {[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}({[hydroxy({[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphoryl]oxy})phosphinic acid | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c2nc(N)[nH]c3=O)O1)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 605.077161 (neutral) |
Table of KEGG reactions in human pathways involving GDP-mannose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00883 | GDP + D-Mannose 1-phosphate <=> Orthophosphate + GDP-mannose | GDP:D-mannose-1-phosphate guanylyltransferase |
R00885 | GTP + D-Mannose 1-phosphate <=> Diphosphate + GDP-mannose | GTP:alpha-D-mannose-1-phosphate guanylyltransferase |
R00888 | GDP-mannose <=> GDP-4-dehydro-6-deoxy-D-mannose + H2O | GDP-alpha-D-mannose 4,6-hydro-lyase (GDP-4-dehydro-alpha-D-rhamnose-forming) |
Table of KEGG human pathways containing GDP-mannose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00051 | Fructose and mannose metabolism | 2 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 2 |
hsa00510 | N-Glycan biosynthesis | 1 |
hsa01100 | Metabolic pathways | 1 |