RefMet Compound Details
RefMet ID | RM0043720 | |
---|---|---|
MW structure | 88606 (View MW Metabolite Database details) | |
RefMet name | GalCer 15:1;O2/10:0 | |
Alternative name | GalCer(d15:1/10:0) | |
Systematic name | N-(decanoyl)-1-beta-galactosyl-4E-pentadecasphingenine | |
SMILES | CCCCCCCCCC/C=C/[C@H]([C@H](CO[C@H]1C(C([C@H]([C@@H](CO)O1)O)O)O)NC(=O)CCCCCCCCC)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | GalCer 25:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 573.424069 (neutral) |
Table of KEGG reactions in human pathways involving GalCer 15:1;O2/10:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01497 | UDP-glucose + N-Acylsphingosine <=> UDP + Glucosylceramide | UDP-glucose:N-acylsphingosine D-glucosyltransferase |
R01498 | Glucosylceramide + H2O <=> D-Glucose + N-Acylsphingosine | D-Glucosyl-N-acylsphingosine glucohydrolase |
R03354 | Glucosylceramide + UDP-alpha-D-galactose <=> Lactosylceramide + UDP | UDP-alpha-D-galactose:beta-D-glucosyl-(1<->1)-ceramide 4-beta-D-galactosyltransferase |
R03355 | Lactosylceramide + H2O <=> Glucosylceramide + D-Galactose | beta-D-Galactosyl-1,4-beta-D-glucosylceramide galactohydrolase |
Table of KEGG human pathways containing GalCer 15:1;O2/10:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00600 | Sphingolipid metabolism | 4 |