RefMet Compound Details
RefMet ID | RM0155869 | |
---|---|---|
MW structure | 50939 (View MW Metabolite Database details) | |
RefMet name | Galactinol | |
Systematic name | alpha-D-galactosyl-(1->3)-1D-myo-inositol | |
SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)O[C@@H]1[C@H]([C@@H]([C@H]([C@@H]([C@@H]1O)O)O)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Galactinol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01194 | alpha-D-Galactosyl-(1->3)-1D-myo-inositol + H2O <=> myo-Inositol + D-Galactose | 3-O-alpha-D-Galactosyl-1D-myo-inositol galactohydrolase |
Table of KEGG human pathways containing Galactinol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 1 |