RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135901 | |
---|---|---|
RefMet name | Glucose | |
Systematic name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | |
Synonyms | PubChem Synonyms | |
Exact mass | 180.063390 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C6H12O6 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37084 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1 | |
InChIKey | WQZGKKKJIJFFOK-GASJEMHNSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O)O1)O)O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Carbohydrates | |
Main Class | Monosaccharides | |
Sub Class | Hexoses | |
Distribution of Glucose in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Glucose | |
External Links | ||
Pubchem CID | 5793 | |
ChEBI ID | 4167 | |
KEGG ID | C00031 | |
HMDB ID | HMDB0304632 | |
Chemspider ID | 5589 | |
EPA CompTox | DTXCID40202844 | |
Spectral data for Glucose standards | ||
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Glucose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00010 | alpha,alpha-Trehalose + H2O <=> 2 D-Glucose | alpha,alpha-trehalose glucohydrolase |
R00028 | Maltose + H2O <=> 2 D-Glucose | maltose glucohydrolase |
R00299 | ATP + D-Glucose <=> ADP + D-Glucose 6-phosphate | ATP:D-glucose 6-phosphotransferase |
R00303 | D-Glucose 6-phosphate + H2O <=> D-Glucose + Orthophosphate | D-Glucose-6-phosphate phosphohydrolase |
R00306 | Cellobiose + H2O <=> 2 D-Glucose | cellobiose glucohydrolase |
R01101 | Melibiose + H2O <=> D-Galactose + D-Glucose | melibiose galactohydrolase |
R01555 | Maltose + Orthophosphate <=> D-Glucose + beta-D-Glucose 1-phosphate | Maltose:phosphate 1-beta-D-glucosyltransferase |
R01600 | ATP + beta-D-Glucose <=> ADP + beta-D-Glucose 6-phosphate | ATP:beta-D-glucose 6-phosphotransferase |
R01602 | alpha-D-Glucose <=> beta-D-Glucose | D-glucose 1-epimerase |
R01718 | Isomaltose + H2O <=> alpha-D-Glucose + D-Glucose | Isomaltose 6-alpha-D-glucanohydrolase |
R01786 | ATP + alpha-D-Glucose <=> ADP + alpha-D-Glucose 6-phosphate | ATP:alpha-D-glucose 6-phosphotransferase |
R01787 | D-Sorbitol + NADP+ <=> alpha-D-Glucose + NADPH + H+ | D-Glucitol:NADP+ 1-oxidoreductase |
R01788 | alpha-D-Glucose 6-phosphate + H2O <=> alpha-D-Glucose + Orthophosphate | alpha-D-Glucose 6-phosphate phosphohydrolase |
R01790 | Starch + H2O <=> D-Glucose + Starch | 1,4-alpha-D-Glucan glucohydrolase |
R01791 | Dextrin + H2O <=> D-Glucose + Dextrin | Dextrin 6-alpha-D-glucanohydrolase |
R02189 | Polyphosphate + alpha-D-Glucose <=> Polyphosphate + alpha-D-Glucose 6-phosphate | Polyphosphate:D-glucose 6-phosphotransferase |
R02727 | alpha,alpha-Trehalose + Orthophosphate <=> D-Glucose + beta-D-Glucose 1-phosphate | alpha,alpha-Trehalose:orthophosphate beta-D-glucosyltransferase |
R02738 | Protein N(pi)-phospho-L-histidine + D-Glucose <=> Protein histidine + alpha-D-Glucose 6-phosphate | protein-N(pi)-phosphohistidine:D-glucose 6-phosphotransferase |
R03527 | beta-D-Glucoside + H2O <=> D-Glucose + ROH | D-Glucoside glucohydrolase |
R05196 | Amylose + n D-Glucose <=> n Maltose | 1,4-alpha-D-Glucan:1,4-alpha-D-glucan 4-alpha-D-glycosyltransferase |
R09085 | alpha-D-Glucose + ADP <=> alpha-D-Glucose 6-phosphate + AMP | ADP:D-glucose 6-phosphotransferase |
R09086 | beta-D-Glucose + ADP <=> beta-D-Glucose 6-phosphate + AMP | ADP:D-glucose 6-phosphotransferase |
Table of KEGG human pathways containing Glucose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00500 | Starch and sucrose metabolism | 10 |
hsa00010 | Glycolysis / Gluconeogenesis | 6 |
hsa00052 | Galactose metabolism | 5 |
hsa01100 | Metabolic pathways | 3 |
hsa01200 | Carbon metabolism | 1 |
hsa01250 | Biosynthesis of nucleotide sugars | 1 |
hsa00051 | Fructose and mannose metabolism | 1 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |
hsa00524 | Neomycin, kanamycin and gentamicin biosynthesis | 1 |