RefMet Compound Details
MW structure | 49880 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Glucuronic acid | |
Systematic name | (2S,3S,4S,5R)-3,4,5,6-tetrakis(oxidanyl)oxane-2-carboxylic acid | |
SMILES | [C@@H]1([C@@H]([C@@H](C(=O)O)OC([C@@H]1O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 194.042655 (neutral) |
Table of KEGG reactions in human pathways involving Glucuronic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01478 | H2O + beta-D-Glucuronoside <=> D-Glucuronate + Alcohol | beta-D-glucuronoside glucuronosohydrolase |
R08615 | UDP-glucuronate + H2O <=> UDP + D-Glucuronate | UDP-glucuronate glucuronohydrolase |
R01184 | myo-Inositol + Oxygen <=> D-Glucuronate + H2O | myo-Inositol:oxygen oxidoreductase |
R01481 | L-Gulonate + NADP+ <=> D-Glucuronate + NADPH + H+ | L-gulonate:NADP+ 6-oxidoreductase |
Table of KEGG human pathways containing Glucuronic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 2 |
hsa00053 | Ascorbate and aldarate metabolism | 2 |
hsa00562 | Inositol phosphate metabolism | 1 |