RefMet Compound Details

MW structure37101 (View MW Metabolite Database details)
RefMet nameGlutamic acid
Systematic name(2S)-2-aminopentanedioic acid
SMILESN[C@@H](CCC(O)=O)C(O)=O
Exact mass147.053159 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC5H9NO4View other entries in RefMet with this formula
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1
InChIKeyWHUUTDBJXJRKMK-VKHMYHEASA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID33032
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)
Human quantitationView measurements in targeted assays on human samples

Table of KEGG reactions in human pathways involving Glutamic acid

Rxn IDKEGG ReactionEnzyme
R00239 ATP + L-Glutamate <=> ADP + L-Glutamyl 5-phosphateATP:L-glutamate 5-phosphotransferase
R00708 (S)-1-Pyrroline-5-carboxylate + NADP+ + 2 H2O <=> L-Glutamate + NADPH + H+(S)-1-pyrroline-5-carboxylate:NADP+ oxidoreductase
R02285 N-Formimino-L-glutamate + H2O <=> L-Glutamate + FormamideN-Formimino-L-glutamate formiminohydrolase
R02287 5-Formiminotetrahydrofolate + L-Glutamate <=> Tetrahydrofolate + N-Formimino-L-glutamate5-Formiminotetrahydrofolate:L-glutamate N-formiminotransferase
R00093 2 L-Glutamate + NAD+ <=> L-Glutamine + 2-Oxoglutarate + NADH + H+L-glutamate:NAD+ oxidoreductase (transaminating)
R00251 ATP + 5-Oxoproline + 2 H2O <=> ADP + Orthophosphate + L-Glutamate5-oxo-L-proline amidohydrolase (ATP-hydrolysing)
R00114 2 L-Glutamate + NADP+ <=> L-Glutamine + 2-Oxoglutarate + NADPH + H+L-glutamate:NADP+ oxidoreductase (transaminating)
R00245 L-Glutamate 5-semialdehyde + NAD+ + H2O <=> L-Glutamate + NADH + H+L-glutamate gamma-semialdehyde:NAD+ oxidoreductase
R00259 Acetyl-CoA + L-Glutamate <=> CoA + N-Acetyl-L-glutamateacetyl-CoA:L-glutamate N-acetyltransferase
R00248 L-Glutamate + NADP+ + H2O <=> 2-Oxoglutarate + Ammonia + NADPH + H+L-glutamate:NADP+ oxidoreductase (deaminating)
R00707 (S)-1-Pyrroline-5-carboxylate + NAD+ + 2 H2O <=> L-Glutamate + NADH + H+(S)-1-pyrroline-5-carboxylate:NAD+ oxidoreductase
R05578 tRNA(Glu) + L-Glutamate + ATP <=> L-Glutamyl-tRNA(Glu) + Diphosphate + AMPL-glutamate:tRNA(Glu) ligase (AMP-forming)
R00261 L-Glutamate <=> 4-Aminobutanoate + CO2L-glutamate 1-carboxy-lyase (4-aminobutanoate-forming)
R00243 L-Glutamate + NAD+ + H2O <=> 2-Oxoglutarate + Ammonia + NADH + H+L-glutamate:NAD+ oxidoreductase (deaminating)

Table of KEGG human pathways containing Glutamic acid

Pathway IDHuman Pathway# of reactions
hsa01230 Biosynthesis of amino acids 3
hsa00250 Alanine, aspartate and glutamate metabolism 2
hsa00260 Glycine, serine and threonine metabolism 2
hsa00330 Arginine and proline metabolism 2
hsa00480 Glutathione metabolism 2
hsa00220 Arginine biosynthesis 2
hsa01200 Carbon metabolism 2
hsa01210 2-Oxocarboxylic acid metabolism 2
hsa00860 Porphyrin and chlorophyll metabolism 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00340 Histidine metabolism 1
hsa00650 Butanoate metabolism 1
hsa00670 One carbon pool by folate 1
  logo