RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135902 | |
---|---|---|
RefMet name | Glyceric acid | |
Systematic name | (2R)-2,3-dihydroxypropanoic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 106.026610 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C3H6O4 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37097 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-/m1/s1 | |
InChIKey | RBNPOMFGQQGHHO-UWTATZPHSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C([C@H](C(=O)O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Carbohydrates | |
Main Class | Monosaccharides | |
Sub Class | Sugar acids | |
Distribution of Glyceric acid in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Glyceric acid | |
External Links | ||
Pubchem CID | 439194 | |
ChEBI ID | 32398 | |
KEGG ID | C00258 | |
HMDB ID | HMDB0000139 | |
Chemspider ID | 388334 | |
MetaCyc ID | GLYCERATE | |
Spectral data for Glyceric acid standards | ||
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Glyceric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01388 | D-Glycerate + NAD+ <=> Hydroxypyruvate + NADH + H+ | D-Glycerate:NAD+ 2-oxidoreductase |
R01392 | D-Glycerate + NADP+ <=> Hydroxypyruvate + NADPH + H+ | D-Glycerate:NADP+ 2-oxidoreductase |
R01752 | D-Glyceraldehyde + NAD+ + H2O <=> D-Glycerate + NADH + H+ | D-Glyceraldehyde:NAD+ oxidoreductase |
R08572 | D-Glycerate + ATP <=> 2-Phospho-D-glycerate + ADP | ATP:(R)-glycerate 2-phosphotransferase |
Table of KEGG human pathways containing Glyceric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00630 | Glyoxylate and dicarboxylate metabolism | 3 |
hsa00260 | Glycine, serine and threonine metabolism | 2 |
hsa00561 | Glycerolipid metabolism | 2 |
hsa00030 | Pentose phosphate pathway | 1 |
hsa01100 | Metabolic pathways | 1 |
hsa01200 | Carbon metabolism | 1 |