RefMet Compound Details

RefMet ID	RM0135888
MW structure	37085 (View MW Metabolite Database details)
RefMet name	Glycine
Systematic name	2-aminoacetic acid
SMILES	C(C(=O)O)N   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass	75.032029 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C2H5NO2	View other entries in RefMet with this formula
InChI	InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
InChIKey	DHMQDGOQFOQNFH-UHFFFAOYSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
Super Class	Organic acids
Main Class	Amino acids and peptides
Sub Class	Amino acids
Pubchem CID	750
ChEBI ID	15428
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Glycine

Rxn ID	KEGG Reaction	Enzyme
R00366	Glycine + H2O + Oxygen <=> Glyoxylate + Ammonia + Hydrogen peroxide	glycine:oxygen oxidoreductase (deaminating)
R00367	S-Adenosyl-L-methionine + Glycine <=> S-Adenosyl-L-homocysteine + Sarcosine	S-Adenosyl-L-methionine:glycine N-methyltransferase
R00371	Acetyl-CoA + Glycine <=> CoA + L-2-Amino-3-oxobutanoic acid	Acetyl-CoA:glycine C-acetyltransferase
R00372	Glycine + 2-Oxoglutarate <=> Glyoxylate + L-Glutamate	Glycine:2-oxoglutarate aminotransferase
R00565	L-Arginine + Glycine <=> L-Ornithine + Guanidinoacetate	L-Arginine:glycine amidinotransferase
R00588	L-Serine + Glyoxylate <=> Hydroxypyruvate + Glycine	L-Serine:glyoxylate aminotransferase
R00610	Sarcosine + H2O + Oxygen <=> Glycine + Formaldehyde + Hydrogen peroxide	sarcosine:oxygen oxidoreductase (demethylating)
R00611	Sarcosine + Electron-transferring flavoprotein + H2O <=> Glycine + Formaldehyde + Reduced electron-transferring flavoprotein	sarcosine:electron-transfer flavoprotein oxidoreductase (demethylating)
R00830	Succinyl-CoA + Glycine <=> 5-Aminolevulinate + CoA + CO2	succinyl-CoA:glycine C-succinyltransferase (decarboxylating)
R00945	5,10-Methylenetetrahydrofolate + Glycine + H2O <=> Tetrahydrofolate + L-Serine	5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase
R01221	Glycine + Tetrahydrofolate + NAD+ <=> 5,10-Methylenetetrahydrofolate + Ammonia + CO2 + NADH + H+	glycine synthase
R03425	Glycine + Lipoylprotein <=> [Protein]-S8-aminomethyldihydrolipoyllysine + CO2	glycine:lipoylprotein oxidoreductase (decarboxylating and acceptor-aminomethylating)
R03654	ATP + Glycine + tRNA(Gly) <=> AMP + Diphosphate + Glycyl-tRNA(Gly)	glycine:tRNA(Gly) ligase (AMP-forming)
R12967	Sarcosine + Tetrahydrofolate + Oxygen <=> Glycine + 5,10-Methylenetetrahydrofolate + Hydrogen peroxide	sarcosine, 5,6,7,8-tetrahydrofolate:O2 oxidoreductase (demethylating,5,10-methylenetetrahydrofolate-forming)
R13029	Sarcosine + 2 Oxidized ferredoxin + H2O <=> Glycine + Formaldehyde + 2 Reduced ferredoxin + 2 H+	sarcosine:ferredoxin oxidoreductase (demethylating)

Table of KEGG human pathways containing Glycine

Pathway ID	Human Pathway	# of reactions
hsa00260	Glycine, serine and threonine metabolism	11
hsa00630	Glyoxylate and dicarboxylate metabolism	3
hsa01100	Metabolic pathways	3
hsa01200	Carbon metabolism	3
hsa00480	Glutathione metabolism	2
hsa01230	Biosynthesis of amino acids	1
hsa00670	One carbon pool by folate	1
hsa00860	Porphyrin and chlorophyll metabolism	1
hsa00970	Aminoacyl-tRNA biosynthesis	1
hsa00120	Primary bile acid biosynthesis	1