RefMet Compound Details
RefMet ID | RM0073716 | |
---|---|---|
MW structure | 51363 (View MW Metabolite Database details) | |
RefMet name | Hexanoyl-CoA | |
Alternative name | CoA 6:0 | |
Systematic name | 3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-4-[(3-{[2-(hexanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-2,2-dimethyl-4-oxobutyl} dihydrogen diphosphate) | |
SMILES | CCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 6:0 | View other entries in RefMet with this sum composition |
Exact mass | 865.188384 (neutral) |
Table of KEGG reactions in human pathways involving Hexanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04747 | Hexanoyl-CoA + Acetyl-CoA <=> CoA + 3-Oxooctanoyl-CoA | Hexanoyl-CoA:acetyl-CoA C-acyltransferase |
R04751 | Hexanoyl-CoA + FAD <=> trans-Hex-2-enoyl-CoA + FADH2 | hexanoyl-CoA:electron-transfer flavoprotein 2,3-oxidoreductase |
R06985 | trans-Hex-2-enoyl-CoA + NADPH + H+ <=> Hexanoyl-CoA + NADP+ | trans-Hex-2-enoyl-CoA reductase |
Table of KEGG human pathways containing Hexanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01212 | Fatty acid metabolism | 3 |
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |