RefMet Compound Details
MW structure | 39032 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Indole-5,6-quinone | |
Systematic name | 5,6-dihydro-1H-indole-5,6-dione | |
SMILES | c1c[nH]c2=CC(=O)C(=O)C=c12 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 147.032029 (neutral) |
Table of KEGG reactions in human pathways involving Indole-5,6-quinone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04884 | 2 5,6-Dihydroxyindole + Oxygen <=> 2 Indole-5,6-quinone + 2 H2O | 5,6-dihydroxyindole:oxygen oxidoreductase |
Table of KEGG human pathways containing Indole-5,6-quinone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 1 |