RefMet Compound Details
RefMet ID | RM0135909 | |
---|---|---|
MW structure | 37131 (View MW Metabolite Database details) | |
RefMet name | Indoleacetic acid | |
Systematic name | 2-(1H-indol-3-yl)acetic acid | |
SMILES | c1ccc2c(c1)c(CC(=O)O)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 175.063329 (neutral) |
Table of KEGG reactions in human pathways involving Indoleacetic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02678 | Indole-3-acetaldehyde + NAD+ + H2O <=> Indole-3-acetate + NADH + H+ | Indole-3-acetaldehyde:NAD+ oxidoreductase |
R02681 | Indole-3-acetaldehyde + Oxygen + H2O <=> Indole-3-acetate + Hydrogen peroxide | indole-3-acetaldehyde:oxygen oxidoreductase |
Table of KEGG human pathways containing Indoleacetic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |