RefMet Compound Details
MW structure | 37625 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Inositol 1,3,4-trisphosphate | |
Systematic name | {[(1S,2R,3R,4S,5S,6S)-2,3,5-trihydroxy-4,6-bis(phosphonooxy)cyclohexyl]oxy}phosphonic acid | |
SMILES | [C@H]1([C@H]([C@@H]([C@H]([C@H]([C@H]1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 419.962379 (neutral) |
Table of KEGG reactions in human pathways involving Inositol 1,3,4-trisphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03430 | 1D-myo-Inositol 1,3,4,5-tetrakisphosphate + H2O <=> 1D-myo-Inositol 1,3,4-trisphosphate + Orthophosphate | D-myo-Inositol 1,3,4,5-tetrakisphosphate 5-phosphohydrolase |
R10950 | 1D-myo-Inositol 1,3,4-trisphosphate + H2O <=> D-myo-Inositol 1,3-bisphosphate + Orthophosphate | 1D-myo-Inositol 1,3,4-trisphosphate 4-phosphohydrolase |
R03427 | 1D-myo-Inositol 1,3,4-trisphosphate + H2O <=> D-myo-Inositol 3,4-bisphosphate + Orthophosphate | D-myo-Inositol 1,3,4-trisphosphate 1-phosphohydrolase |
R03393 | 1D-myo-Inositol 1,4-bisphosphate + H2O <=> myo-Inositol 4-phosphate + Orthophosphate | D-myo-Inositol-1,4-bisphosphate 1-phosphohydrolase |
R03429 | ATP + 1D-myo-Inositol 1,3,4-trisphosphate <=> ADP + 1D-myo-Inositol 1,3,4,6-tetrakisphosphate | ATP:1D-myo-inositol-1,3,4-trisphosphate 6-phosphotransferase |
R03428 | ATP + 1D-myo-Inositol 1,3,4-trisphosphate <=> ADP + 1D-myo-Inositol 1,3,4,5-tetrakisphosphate | ATP:1D-myo-inositol-1,3,4-trisphosphate 5-phosphotransferase |
Table of KEGG human pathways containing Inositol 1,3,4-trisphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00562 | Inositol phosphate metabolism | 4 |
hsa04070 | Phosphatidylinositol signaling system | 4 |