RefMet Compound Details
RefMet ID | RM0153959 | |
---|---|---|
MW structure | 37679 (View MW Metabolite Database details) | |
RefMet name | Isobutyryl-CoA | |
Alternative name | CoA 3:0;2Me | |
Systematic name | {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({hydroxy[(3R)-3-hydroxy-2,2-dimethyl-3-{[2-({2-[(2-methylpropanoyl)sulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}propoxy]phosphoryl}oxy)phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid | |
SMILES | CC(C)C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 4:0 | View other entries in RefMet with this sum composition |
Exact mass | 837.157084 (neutral) |
Table of KEGG reactions in human pathways involving Isobutyryl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02661 | 2-Methylpropanoyl-CoA + Acceptor <=> 2-Methylprop-2-enoyl-CoA + Reduced acceptor | 2-methylpropanoyl-CoA:(acceptor) 2,3-oxidoreductase |
R02662 | 2-Methylpropanoyl-CoA + Enzyme N6-(dihydrolipoyl)lysine <=> CoA + [Dihydrolipoyllysine-residue (2-methylpropanoyl)transferase] S-(2-methylpropanoyl)dihydrolipoyllysine | 2-methylpropanoyl-CoA:enzyme N6-(dihydrolipoyl)lysine S-(2-methylpropanoyl)transferase |
Table of KEGG human pathways containing Isobutyryl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |