RefMet Compound Details
MW structure | 34963 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Isofucosterol | |
Systematic name | 24Z-ethylidene-cholest-5-en-3beta-ol | |
SMILES | C/C=C(/CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)\C(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 29:2;O | View other entries in RefMet with this sum composition |
Exact mass | 412.370515 (neutral) |
Table of KEGG reactions in human pathways involving Isofucosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07487 | 5-Dehydroavenasterol <=> Isofucosterol | 5-Dehydroavenasterol <=> Isofucosterol |
R07488 | Isofucosterol + NADPH + H+ <=> beta-Sitosterol + NADP+ | Isofucosterol + NADPH + H+ <=> beta-Sitosterol + NADP+ |
Table of KEGG human pathways containing Isofucosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |