RefMet Compound Details
RefMet ID | RM0135299 | |
---|---|---|
MW structure | 27999 (View MW Metabolite Database details) | |
RefMet name | Isopentenyl-diphosphate | |
Systematic name | 3-methylbut-3-enyl pyrophosphate | |
SMILES | C=C(C)CCOP(=O)(O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 246.005831 (neutral) |
Table of KEGG reactions in human pathways involving Isopentenyl-diphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01121 | ATP + (R)-5-Diphosphomevalonate <=> ADP + Orthophosphate + Isopentenyl diphosphate + CO2 | ATP:(R)-5-diphosphomevalonate carboxy-lyase (adding ATP |
R01123 | Isopentenyl diphosphate <=> Dimethylallyl diphosphate | Isopentenyl-diphosphate delta3-delta2-isomerase |
Table of KEGG human pathways containing Isopentenyl-diphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00900 | Terpenoid backbone biosynthesis | 5 |