RefMet Compound Details
RefMet ID | RM0186591 | |
---|---|---|
MW structure | 204323 (View MW Metabolite Database details) | |
RefMet name | KDN 9-phosphate | |
Systematic name | 3-Deoxy-D-glycero-D-galacto-non-2-ulopyranosonate 9-phosphate | |
SMILES | C1[C@@H]([C@H]([C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)OC1(C(=O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 348.045768 (neutral) |
Table of KEGG reactions in human pathways involving KDN 9-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R11439 | Phosphoenolpyruvate + D-Mannose 6-phosphate + H2O <=> 3-Deoxy-D-glycero-D-galacto-non-2-ulopyranosonate 9-phosphate + Orthophosphate | phosphoenolpyruvate:D-mannose-6-phosphate 1-(2-carboxy-2-oxoethyl)transferase |
Table of KEGG human pathways containing KDN 9-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |
hsa01250 | Biosynthesis of nucleotide sugars | 1 |