RefMet Compound Details
MW structure | 40890 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Ketoprofen glucuronide | |
Systematic name | (2S,3S,4S,5R,6S)-6-{[2-(3-benzoylphenyl)propanoyl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid | |
SMILES | CC(c1cccc(c1)C(=O)c1ccccc1)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 430.126385 (neutral) |
Table of KEGG reactions in human pathways involving Ketoprofen glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01478 | H2O + beta-D-Glucuronoside <=> D-Glucuronate + Alcohol | beta-D-glucuronoside glucuronosohydrolase |
R01383 | UDP-glucuronate + ROH <=> UDP + beta-D-Glucuronoside | UDPglucuronate beta-D-glucuronosyltransferase (acceptor-unspecific) |
Table of KEGG human pathways containing Ketoprofen glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 2 |