RefMet Compound Details
MW structure | 37672 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | L-Glutamic acid 5-phosphate | |
Systematic name | (2S)-2-amino-5-oxo-5-(phosphonooxy)pentanoic acid | |
SMILES | C(CC(=O)OP(=O)(O)O)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 227.019488 (neutral) |
Table of KEGG reactions in human pathways involving L-Glutamic acid 5-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00239 | ATP + L-Glutamate <=> ADP + L-Glutamyl 5-phosphate | ATP:L-glutamate 5-phosphotransferase |
R03313 | L-Glutamate 5-semialdehyde + Orthophosphate + NADP+ <=> L-Glutamyl 5-phosphate + NADPH + H+ | L-glutamate-5-semialdehyde:NADP+ 5-oxidoreductase (phosphorylating) |
Table of KEGG human pathways containing L-Glutamic acid 5-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00330 | Arginine and proline metabolism | 2 |
hsa01230 | Biosynthesis of amino acids | 2 |